C13H17ClN2O5S — CID 75405739
3-(4-chlorophenyl)-3-(morpholin-4-ylsulfonylamino)propanoic acid (PubChem CID 75405739) has the molecular formula C13H17ClN2O5S and a molecular weight of 348.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(morpholin-4-ylsulfonylamino)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-(morpholin-4-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 75405739 |
| Molecular Formula | C13H17ClN2O5S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(morpholin-4-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)N1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O5S/c14-11-3-1-10(2-4-11)12(9-13(17)18)15-22(19,20)16-5-7-21-8-6-16/h1-4,12,15H,5-9H2,(H,17,18) |
| InChIKey | KYBVSVPVCPRRFK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |