C9H14N2O2S2 — CID 71645820
N-[(3R)-piperidin-3-yl]thiophene-2-sulfonamide (PubChem CID 71645820) has the molecular formula C9H14N2O2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is N-[(3R)-piperidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(3R)-piperidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 71645820 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | N-[(3R)-piperidin-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCNC1)c1cccs1 |
| InChI | InChI=1S/C9H14N2O2S2/c12-15(13,9-4-2-6-14-9)11-8-3-1-5-10-7-8/h2,4,6,8,10-11H,1,3,5,7H2/t8-/m1/s1 |
| InChIKey | PQMOBQUPCCGTIY-MRVPVSSYSA-N |
| XLogP | 0.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |