C15H18N2O2S — CID 63321555
N-piperidin-3-ylnaphthalene-2-sulfonamide (PubChem CID 63321555) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-piperidin-3-ylnaphthalene-2-sulfonamide.
| Compound Name | N-piperidin-3-ylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 63321555 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-piperidin-3-ylnaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCCNC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H18N2O2S/c18-20(19,17-14-6-3-9-16-11-14)15-8-7-12-4-1-2-5-13(12)10-15/h1-2,4-5,7-8,10,14,16-17H,3,6,9,11H2 |
| InChIKey | HJAKWYTVIADIIH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |