C9H15N3O2S2 — CID 103951401
2-methyl-N-piperidin-3-yl-1,3-thiazole-5-sulfonamide (PubChem CID 103951401) has the molecular formula C9H15N3O2S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-methyl-N-piperidin-3-yl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-methyl-N-piperidin-3-yl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103951401 |
| Molecular Formula | C9H15N3O2S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-methyl-N-piperidin-3-yl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NC2CCCNC2)s1 |
| InChI | InChI=1S/C9H15N3O2S2/c1-7-11-6-9(15-7)16(13,14)12-8-3-2-4-10-5-8/h6,8,10,12H,2-5H2,1H3 |
| InChIKey | LJJUTCXSZOHEGI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |