C7H11N3O2S2 — CID 103951396
N-(2-aminocyclopropyl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103951396) has the molecular formula C7H11N3O2S2 and a molecular weight of 233.32 g/mol. Its IUPAC name is N-(2-aminocyclopropyl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(2-aminocyclopropyl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103951396 |
| Molecular Formula | C7H11N3O2S2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | N-(2-aminocyclopropyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NC2CC2N)s1 |
| InChI | InChI=1S/C7H11N3O2S2/c1-4-9-3-7(13-4)14(11,12)10-6-2-5(6)8/h3,5-6,10H,2,8H2,1H3 |
| InChIKey | IWOAYVFYZLKCQW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |