C10H16N4O3S2 — CID 103415692
N'-hydroxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclopentane-1-carboximidamide (PubChem CID 103415692) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is N'-hydroxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclopentane-1-carboximidamide.
| Compound Name | N'-hydroxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 103415692 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N'-hydroxy-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclopentane-1-carboximidamide |
| SMILES | Cc1ncc(S(=O)(=O)NC2CCCC2/C(N)=N/O)s1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-6-12-5-9(18-6)19(16,17)14-8-4-2-3-7(8)10(11)13-15/h5,7-8,14-15H,2-4H2,1H3,(H2,11,13) |
| InChIKey | AIISJWWQYDHZPP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|