C9H19N3O3S — CID 76978990
N'-hydroxy-2-(propylsulfonylamino)cyclopentane-1-carboximidamide (PubChem CID 76978990) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is N'-hydroxy-2-(propylsulfonylamino)cyclopentane-1-carboximidamide.
| Compound Name | N'-hydroxy-2-(propylsulfonylamino)cyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 76978990 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | N'-hydroxy-2-(propylsulfonylamino)cyclopentane-1-carboximidamide |
| SMILES | CCCS(=O)(=O)NC1CCCC1C(N)=NO |
| InChI | InChI=1S/C9H19N3O3S/c1-2-6-16(14,15)12-8-5-3-4-7(8)9(10)11-13/h7-8,12-13H,2-6H2,1H3,(H2,10,11) |
| InChIKey | WPMLYXVONJHGRH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|