C9H18N2O4S3 — CID 63243310
2-(2-methylsulfonylethylsulfonylamino)cyclopentane-1-carbothioamide (PubChem CID 63243310) has the molecular formula C9H18N2O4S3 and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-(2-methylsulfonylethylsulfonylamino)cyclopentane-1-carbothioamide.
| Compound Name | 2-(2-methylsulfonylethylsulfonylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 63243310 |
| Molecular Formula | C9H18N2O4S3 |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-(2-methylsulfonylethylsulfonylamino)cyclopentane-1-carbothioamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NC1CCCC1C(N)=S |
| InChI | InChI=1S/C9H18N2O4S3/c1-17(12,13)5-6-18(14,15)11-8-4-2-3-7(8)9(10)16/h7-8,11H,2-6H2,1H3,(H2,10,16) |
| InChIKey | BPPUHFZOHAGSPW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|