C12H13BrCl2N2O2S2 — CID 62957295
2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide (PubChem CID 62957295) has the molecular formula C12H13BrCl2N2O2S2 and a molecular weight of 432.19 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide.
| Compound Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 62957295 |
| Molecular Formula | C12H13BrCl2N2O2S2 |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1CCCC1NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C12H13BrCl2N2O2S2/c13-6-4-8(14)11(9(15)5-6)21(18,19)17-10-3-1-2-7(10)12(16)20/h4-5,7,10,17H,1-3H2,(H2,16,20) |
| InChIKey | UDQVABTVLGETAX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|