C11H14BrCl2NO2S — CID 42999395
4-bromo-2,6-dichloro-N-(3-methylbutan-2-yl)benzenesulfonamide (PubChem CID 42999395) has the molecular formula C11H14BrCl2NO2S and a molecular weight of 375.12 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(3-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(3-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 42999395 |
| Molecular Formula | C11H14BrCl2NO2S |
| Molecular Weight | 375.12 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(3-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CC(C)C(C)NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H14BrCl2NO2S/c1-6(2)7(3)15-18(16,17)11-9(13)4-8(12)5-10(11)14/h4-7,15H,1-3H3 |
| InChIKey | DPGHNXPDIFFMIM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.12 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |