C10H11BrCl2N2O2S2 — CID 43120112
3-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]propanethioamide (PubChem CID 43120112) has the molecular formula C10H11BrCl2N2O2S2 and a molecular weight of 406.15 g/mol. Its IUPAC name is 3-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]propanethioamide.
| Compound Name | 3-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]propanethioamide |
|---|---|
| PubChem CID | 43120112 |
| Molecular Formula | C10H11BrCl2N2O2S2 |
| Molecular Weight | 406.15 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | 3-[(4-bromo-2,6-dichlorophenyl)sulfonyl-methylamino]propanethioamide |
| SMILES | CN(CCC(N)=S)S(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H11BrCl2N2O2S2/c1-15(3-2-9(14)18)19(16,17)10-7(12)4-6(11)5-8(10)13/h4-5H,2-3H2,1H3,(H2,14,18) |
| InChIKey | JHXNRJYGCOYBLN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|