C10H9BrCl2F3NO2S — CID 104854799
4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide (PubChem CID 104854799) has the molecular formula C10H9BrCl2F3NO2S and a molecular weight of 415.06 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 104854799 |
| Molecular Formula | C10H9BrCl2F3NO2S |
| Molecular Weight | 415.06 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H9BrCl2F3NO2S/c1-5(4-10(14,15)16)17-20(18,19)9-7(12)2-6(11)3-8(9)13/h2-3,5,17H,4H2,1H3 |
| InChIKey | VOJLCRMKVLDHIL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.06 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |