C12H14BrCl2F3N2O2S — CID 112826107
4-bromo-2,6-dichloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzenesulfonamide (PubChem CID 112826107) has the molecular formula C12H14BrCl2F3N2O2S and a molecular weight of 458.13 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112826107 |
| Molecular Formula | C12H14BrCl2F3N2O2S |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 455.93 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzenesulfonamide |
| SMILES | CN(CCCNS(=O)(=O)c1c(Cl)cc(Br)cc1Cl)CC(F)(F)F |
| InChI | InChI=1S/C12H14BrCl2F3N2O2S/c1-20(7-12(16,17)18)4-2-3-19-23(21,22)11-9(14)5-8(13)6-10(11)15/h5-6,19H,2-4,7H2,1H3 |
| InChIKey | ZFMHWVAMFSJNJC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|