C11H21N3O2S2 — CID 62957475
2-(piperidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide (PubChem CID 62957475) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-(piperidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide.
| Compound Name | 2-(piperidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide |
|---|---|
| PubChem CID | 62957475 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-(piperidin-1-ylsulfonylamino)cyclopentane-1-carbothioamide |
| SMILES | NC(=S)C1CCCC1NS(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H21N3O2S2/c12-11(17)9-5-4-6-10(9)13-18(15,16)14-7-2-1-3-8-14/h9-10,13H,1-8H2,(H2,12,17) |
| InChIKey | WJRGSKKWDAACJK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|