C6H14N4O3S — CID 104985778
N'-hydroxy-2-(sulfamoylamino)cyclopentane-1-carboximidamide (PubChem CID 104985778) has the molecular formula C6H14N4O3S and a molecular weight of 222.27 g/mol. Its IUPAC name is N'-hydroxy-2-(sulfamoylamino)cyclopentane-1-carboximidamide.
| Compound Name | N'-hydroxy-2-(sulfamoylamino)cyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 104985778 |
| Molecular Formula | C6H14N4O3S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N'-hydroxy-2-(sulfamoylamino)cyclopentane-1-carboximidamide |
| SMILES | NC(=NO)C1CCCC1NS(N)(=O)=O |
| InChI | InChI=1S/C6H14N4O3S/c7-6(9-11)4-2-1-3-5(4)10-14(8,12)13/h4-5,10-11H,1-3H2,(H2,7,9)(H2,8,12,13) |
| InChIKey | IDKDAKMCXLZXMV-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|