C9H20N2O2S — CID 93452968
N-[(1R,2R)-2-aminocyclohexyl]propane-1-sulfonamide (PubChem CID 93452968) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]propane-1-sulfonamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 93452968 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C9H20N2O2S/c1-2-7-14(12,13)11-9-6-4-3-5-8(9)10/h8-9,11H,2-7,10H2,1H3/t8-,9-/m1/s1 |
| InChIKey | MFGIJQKRYVIDRK-RKDXNWHRSA-N |
| XLogP | 0.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |