C20H34N2O2S — CID 59537766
N-(2-aminocyclohexyl)-2-[2,6-di(propan-2-yl)phenyl]ethanesulfonamide (PubChem CID 59537766) has the molecular formula C20H34N2O2S and a molecular weight of 366.57 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-2-[2,6-di(propan-2-yl)phenyl]ethanesulfonamide.
| Compound Name | N-(2-aminocyclohexyl)-2-[2,6-di(propan-2-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 59537766 |
| Molecular Formula | C20H34N2O2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-(2-aminocyclohexyl)-2-[2,6-di(propan-2-yl)phenyl]ethanesulfonamide |
| SMILES | CC(C)c1cccc(C(C)C)c1CCS(=O)(=O)NC1CCCCC1N |
| InChI | InChI=1S/C20H34N2O2S/c1-14(2)16-8-7-9-17(15(3)4)18(16)12-13-25(23,24)22-20-11-6-5-10-19(20)21/h7-9,14-15,19-20,22H,5-6,10-13,21H2,1-4H3 |
| InChIKey | JAMQZEPWOWDIPU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |