C13H21N3O2S — CID 93453148
N-[(1R,2R)-2-aminocyclohexyl]-2-pyridin-2-ylethanesulfonamide (PubChem CID 93453148) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 93453148 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-2-pyridin-2-ylethanesulfonamide |
| SMILES | N[C@@H]1CCCC[C@H]1NS(=O)(=O)CCc1ccccn1 |
| InChI | InChI=1S/C13H21N3O2S/c14-12-6-1-2-7-13(12)16-19(17,18)10-8-11-5-3-4-9-15-11/h3-5,9,12-13,16H,1-2,6-8,10,14H2/t12-,13-/m1/s1 |
| InChIKey | UYZIOKDDMBBOQM-CHWSQXEVSA-N |
| XLogP | 0.81 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |