C13H19ClN2O2S — CID 114179778
N-[2-(chloromethyl)cyclopentyl]-2-pyridin-2-ylethanesulfonamide (PubChem CID 114179778) has the molecular formula C13H19ClN2O2S and a molecular weight of 302.83 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclopentyl]-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-[2-(chloromethyl)cyclopentyl]-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 114179778 |
| Molecular Formula | C13H19ClN2O2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[2-(chloromethyl)cyclopentyl]-2-pyridin-2-ylethanesulfonamide |
| SMILES | O=S(=O)(CCc1ccccn1)NC1CCCC1CCl |
| InChI | InChI=1S/C13H19ClN2O2S/c14-10-11-4-3-6-13(11)16-19(17,18)9-7-12-5-1-2-8-15-12/h1-2,5,8,11,13,16H,3-4,6-7,9-10H2 |
| InChIKey | YSQRZMALJFBRMX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|