C13H17N3O2S — CID 61123473
N-(1-cyanocyclopentyl)-2-pyridin-2-ylethanesulfonamide (PubChem CID 61123473) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2-pyridin-2-ylethanesulfonamide.
| Compound Name | N-(1-cyanocyclopentyl)-2-pyridin-2-ylethanesulfonamide |
|---|---|
| PubChem CID | 61123473 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2-pyridin-2-ylethanesulfonamide |
| SMILES | N#CC1(NS(=O)(=O)CCc2ccccn2)CCCC1 |
| InChI | InChI=1S/C13H17N3O2S/c14-11-13(7-2-3-8-13)16-19(17,18)10-6-12-5-1-4-9-15-12/h1,4-5,9,16H,2-3,6-8,10H2 |
| InChIKey | ZRIZZNKKVQAPKI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |