C12H18N2O — CID 93317378
trans-(1S,2S)-2-(2-pyridin-2-ylethylamino)cyclopentan-1-ol (PubChem CID 93317378) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-pyridin-2-ylethylamino)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-pyridin-2-ylethylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 93317378 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | trans-(1S,2S)-2-(2-pyridin-2-ylethylamino)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1NCCc1ccccn1 |
| InChI | InChI=1S/C12H18N2O/c15-12-6-3-5-11(12)14-9-7-10-4-1-2-8-13-10/h1-2,4,8,11-12,14-15H,3,5-7,9H2/t11-,12-/m0/s1 |
| InChIKey | YKIAQVQRDCNJGG-RYUDHWBXSA-N |
| XLogP | 1.13 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |