C13H21N3 — CID 79724278
4-N-(2-pyridin-2-ylethyl)cyclohexane-1,4-diamine (PubChem CID 79724278) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-N-(2-pyridin-2-ylethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(2-pyridin-2-ylethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79724278 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4-N-(2-pyridin-2-ylethyl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCCc2ccccn2)CC1 |
| InChI | InChI=1S/C13H21N3/c14-11-4-6-13(7-5-11)16-10-8-12-3-1-2-9-15-12/h1-3,9,11,13,16H,4-8,10,14H2 |
| InChIKey | AHSSECVXWDLUDR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |