C14H22N2 — CID 103560787
3-propan-2-yl-N-(2-pyridin-2-ylethyl)cyclobutan-1-amine (PubChem CID 103560787) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-propan-2-yl-N-(2-pyridin-2-ylethyl)cyclobutan-1-amine.
| Compound Name | 3-propan-2-yl-N-(2-pyridin-2-ylethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 103560787 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 3-propan-2-yl-N-(2-pyridin-2-ylethyl)cyclobutan-1-amine |
| SMILES | CC(C)C1CC(NCCc2ccccn2)C1 |
| InChI | InChI=1S/C14H22N2/c1-11(2)12-9-14(10-12)16-8-6-13-5-3-4-7-15-13/h3-5,7,11-12,14,16H,6,8-10H2,1-2H3 |
| InChIKey | WVGJRMHJEBWURV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |