C16H20N2O — CID 102733860
trans-(1R,2R)-2-(2-quinolin-8-ylethylamino)cyclopentan-1-ol (PubChem CID 102733860) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2-quinolin-8-ylethylamino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2-quinolin-8-ylethylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102733860 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | trans-(1R,2R)-2-(2-quinolin-8-ylethylamino)cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1NCCc1cccc2cccnc12 |
| InChI | InChI=1S/C16H20N2O/c19-15-8-2-7-14(15)17-11-9-13-5-1-4-12-6-3-10-18-16(12)13/h1,3-6,10,14-15,17,19H,2,7-9,11H2/t14-,15-/m1/s1 |
| InChIKey | UJNXJZGOLVLDFW-HUUCEWRRSA-N |
| XLogP | 2.28 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |