C17H23N3 — CID 97223040
(3R,4R)-1,4-dimethyl-N-(2-quinolin-8-ylethyl)pyrrolidin-3-amine (PubChem CID 97223040) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is (3R,4R)-1,4-dimethyl-N-(2-quinolin-8-ylethyl)pyrrolidin-3-amine.
| Compound Name | (3R,4R)-1,4-dimethyl-N-(2-quinolin-8-ylethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 97223040 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | (3R,4R)-1,4-dimethyl-N-(2-quinolin-8-ylethyl)pyrrolidin-3-amine |
| SMILES | C[C@@H]1CN(C)C[C@@H]1NCCc1cccc2cccnc12 |
| InChI | InChI=1S/C17H23N3/c1-13-11-20(2)12-16(13)18-10-8-15-6-3-5-14-7-4-9-19-17(14)15/h3-7,9,13,16,18H,8,10-12H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | SSOQXIHJPYJZQL-CJNGLKHVSA-N |
| XLogP | 2.32 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |