C15H24N2O4S — CID 59537552
N-(2-aminocyclohexyl)-1-(3,5-dimethoxyphenyl)methanesulfonamide (PubChem CID 59537552) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is N-(2-aminocyclohexyl)-1-(3,5-dimethoxyphenyl)methanesulfonamide.
| Compound Name | N-(2-aminocyclohexyl)-1-(3,5-dimethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 59537552 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(2-aminocyclohexyl)-1-(3,5-dimethoxyphenyl)methanesulfonamide |
| SMILES | COc1cc(CS(=O)(=O)NC2CCCCC2N)cc(OC)c1 |
| InChI | InChI=1S/C15H24N2O4S/c1-20-12-7-11(8-13(9-12)21-2)10-22(18,19)17-15-6-4-3-5-14(15)16/h7-9,14-15,17H,3-6,10,16H2,1-2H3 |
| InChIKey | YURFXROQXHNWQY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |