C11H18N4O4S — CID 119964205
ethyl 5-(piperidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 119964205) has the molecular formula C11H18N4O4S and a molecular weight of 302.36 g/mol. Its IUPAC name is ethyl 5-(piperidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(piperidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 119964205 |
| Molecular Formula | C11H18N4O4S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | ethyl 5-(piperidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NC1CCCNC1 |
| InChI | InChI=1S/C11H18N4O4S/c1-2-19-11(16)9-7-13-14-10(9)20(17,18)15-8-4-3-5-12-6-8/h7-8,12,15H,2-6H2,1H3,(H,13,14) |
| InChIKey | BBDDJRDCLIKZRD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |