C10H15N3O4S — CID 60727337
ethyl 5-(cyclopropylmethylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 60727337) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is ethyl 5-(cyclopropylmethylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(cyclopropylmethylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 60727337 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | ethyl 5-(cyclopropylmethylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NCC1CC1 |
| InChI | InChI=1S/C10H15N3O4S/c1-2-17-10(14)8-6-11-13-9(8)18(15,16)12-5-7-3-4-7/h6-7,12H,2-5H2,1H3,(H,11,13) |
| InChIKey | ASDGHODIVVYFJJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |