C11H17N3O5S — CID 60911937
ethyl 5-(oxan-4-ylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 60911937) has the molecular formula C11H17N3O5S and a molecular weight of 303.34 g/mol. Its IUPAC name is ethyl 5-(oxan-4-ylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(oxan-4-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 60911937 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 5-(oxan-4-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NC1CCOCC1 |
| InChI | InChI=1S/C11H17N3O5S/c1-2-19-11(15)9-7-12-13-10(9)20(16,17)14-8-3-5-18-6-4-8/h7-8,14H,2-6H2,1H3,(H,12,13) |
| InChIKey | HLJHLSSJNWBPGH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |