C8H12N4O6S — CID 112672393
ethyl 5-[(2-amino-2-oxoethoxy)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 112672393) has the molecular formula C8H12N4O6S and a molecular weight of 292.27 g/mol. Its IUPAC name is ethyl 5-[(2-amino-2-oxoethoxy)sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-amino-2-oxoethoxy)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 112672393 |
| Molecular Formula | C8H12N4O6S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | ethyl 5-[(2-amino-2-oxoethoxy)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NOCC(N)=O |
| InChI | InChI=1S/C8H12N4O6S/c1-2-17-8(14)5-3-10-11-7(5)19(15,16)12-18-4-6(9)13/h3,12H,2,4H2,1H3,(H2,9,13)(H,10,11) |
| InChIKey | ZJDOCYGQQBRZLJ-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|