C8H13N3O4S — CID 51330519
ethyl 5-(dimethylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 51330519) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is ethyl 5-(dimethylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(dimethylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 51330519 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | ethyl 5-(dimethylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H13N3O4S/c1-4-15-8(12)6-5-9-10-7(6)16(13,14)11(2)3/h5H,4H2,1-3H3,(H,9,10) |
| InChIKey | YNRXMZFRVXZPAX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |