C12H20N4O4S — CID 63165064
ethyl 5-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate (PubChem CID 63165064) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is ethyl 5-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 63165064 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 5-[3-(dimethylamino)pyrrolidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)N1CCC(N(C)C)C1 |
| InChI | InChI=1S/C12H20N4O4S/c1-4-20-12(17)10-7-13-14-11(10)21(18,19)16-6-5-9(8-16)15(2)3/h7,9H,4-6,8H2,1-3H3,(H,13,14) |
| InChIKey | BQMHWNGCYVQIHE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |