C14H23N3O5S — CID 125139928
ethyl 5-[(2S)-2-tert-butylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylate (PubChem CID 125139928) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is ethyl 5-[(2S)-2-tert-butylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2S)-2-tert-butylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 125139928 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | ethyl 5-[(2S)-2-tert-butylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)N1CCO[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C14H23N3O5S/c1-5-21-13(18)10-8-15-16-12(10)23(19,20)17-6-7-22-11(9-17)14(2,3)4/h8,11H,5-7,9H2,1-4H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | OVXMAVFZICFYFA-LLVKDONJSA-N |
| XLogP | 1.02 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |