C12H19N3O5S — CID 60911817
ethyl 5-[2-(hydroxymethyl)piperidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate (PubChem CID 60911817) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is ethyl 5-[2-(hydroxymethyl)piperidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[2-(hydroxymethyl)piperidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 60911817 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethyl 5-[2-(hydroxymethyl)piperidin-1-yl]sulfonyl-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)N1CCCCC1CO |
| InChI | InChI=1S/C12H19N3O5S/c1-2-20-12(17)10-7-13-14-11(10)21(18,19)15-6-4-3-5-9(15)8-16/h7,9,16H,2-6,8H2,1H3,(H,13,14) |
| InChIKey | NBFDMXYCQDATIB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |