C12H21N3O4S — CID 47141011
ethyl 5-(dipropylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 47141011) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is ethyl 5-(dipropylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(dipropylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 47141011 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | ethyl 5-(dipropylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCCN(CCC)S(=O)(=O)c1[nH]ncc1C(=O)OCC |
| InChI | InChI=1S/C12H21N3O4S/c1-4-7-15(8-5-2)20(17,18)11-10(9-13-14-11)12(16)19-6-3/h9H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | LZEICMQXULTJQO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |