C10H17N3O4S — CID 47265875
ethyl 5-[methyl(propyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 47265875) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is ethyl 5-[methyl(propyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[methyl(propyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 47265875 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | ethyl 5-[methyl(propyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCCN(C)S(=O)(=O)c1[nH]ncc1C(=O)OCC |
| InChI | InChI=1S/C10H17N3O4S/c1-4-6-13(3)18(15,16)9-8(7-11-12-9)10(14)17-5-2/h7H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | GWUYJPOVDOGYNP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |