C13H23ClN4O4S — CID 119976480
ethyl 5-[propyl(pyrrolidin-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride (PubChem CID 119976480) has the molecular formula C13H23ClN4O4S and a molecular weight of 366.87 g/mol. Its IUPAC name is ethyl 5-[propyl(pyrrolidin-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride.
| Compound Name | ethyl 5-[propyl(pyrrolidin-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119976480 |
| Molecular Formula | C13H23ClN4O4S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | ethyl 5-[propyl(pyrrolidin-3-yl)sulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)c1[nH]ncc1C(=O)OCC.Cl |
| InChI | InChI=1S/C13H22N4O4S.ClH/c1-3-7-17(10-5-6-14-8-10)22(19,20)12-11(9-15-16-12)13(18)21-4-2;/h9-10,14H,3-8H2,1-2H3,(H,15,16);1H |
| InChIKey | ZFKLBERURGTUGI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |