C10H16N4O4S — CID 119966905
ethyl 5-(pyrrolidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 119966905) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is ethyl 5-(pyrrolidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(pyrrolidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 119966905 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | ethyl 5-(pyrrolidin-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NC1CCNC1 |
| InChI | InChI=1S/C10H16N4O4S/c1-2-18-10(15)8-6-12-13-9(8)19(16,17)14-7-3-4-11-5-7/h6-7,11,14H,2-5H2,1H3,(H,12,13) |
| InChIKey | PKZYPRAILKBLGD-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |