C10H15N3O6S — CID 60713652
ethyl 5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 60713652) has the molecular formula C10H15N3O6S and a molecular weight of 305.31 g/mol. Its IUPAC name is ethyl 5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 60713652 |
| Molecular Formula | C10H15N3O6S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | ethyl 5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NC(C)C(=O)OC |
| InChI | InChI=1S/C10H15N3O6S/c1-4-19-10(15)7-5-11-12-8(7)20(16,17)13-6(2)9(14)18-3/h5-6,13H,4H2,1-3H3,(H,11,12) |
| InChIKey | GBQWNVJUWACXHL-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |