C11H19N3O4S2 — CID 63967060
ethyl 5-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 63967060) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is ethyl 5-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 63967060 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 5-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NCC(C)CSC |
| InChI | InChI=1S/C11H19N3O4S2/c1-4-18-11(15)9-6-12-14-10(9)20(16,17)13-5-8(2)7-19-3/h6,8,13H,4-5,7H2,1-3H3,(H,12,14) |
| InChIKey | QZZOSNHMUZHKSM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |