C11H20N4O4S — CID 61403878
ethyl 5-[3-(ethylamino)propylsulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 61403878) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is ethyl 5-[3-(ethylamino)propylsulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[3-(ethylamino)propylsulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 61403878 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | ethyl 5-[3-(ethylamino)propylsulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCNCCCNS(=O)(=O)c1[nH]ncc1C(=O)OCC |
| InChI | InChI=1S/C11H20N4O4S/c1-3-12-6-5-7-14-20(17,18)10-9(8-13-15-10)11(16)19-4-2/h8,12,14H,3-7H2,1-2H3,(H,13,15) |
| InChIKey | YHHHGHNNNUGUCZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|