C12H23ClN4O4S — CID 119981227
ethyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride (PubChem CID 119981227) has the molecular formula C12H23ClN4O4S and a molecular weight of 354.86 g/mol. Its IUPAC name is ethyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride.
| Compound Name | ethyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119981227 |
| Molecular Formula | C12H23ClN4O4S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | ethyl 5-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1H-pyrazole-4-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NC(CC)(CC)CN.Cl |
| InChI | InChI=1S/C12H22N4O4S.ClH/c1-4-12(5-2,8-13)16-21(18,19)10-9(7-14-15-10)11(17)20-6-3;/h7,16H,4-6,8,13H2,1-3H3,(H,14,15);1H |
| InChIKey | FNGLMIIBYAKFHM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |