C11H19N3O5S — CID 115755167
ethyl 5-(1-hydroxypentan-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 115755167) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is ethyl 5-(1-hydroxypentan-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(1-hydroxypentan-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 115755167 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | ethyl 5-(1-hydroxypentan-3-ylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NC(CC)CCO |
| InChI | InChI=1S/C11H19N3O5S/c1-3-8(5-6-15)14-20(17,18)10-9(7-12-13-10)11(16)19-4-2/h7-8,14-15H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | CZHNAVZCEGRUTD-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |