C13H17N3O4S2 — CID 51330938
ethyl 5-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]-1H-pyrazole-4-carboxylate (PubChem CID 51330938) has the molecular formula C13H17N3O4S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 5-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 51330938 |
| Molecular Formula | C13H17N3O4S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | ethyl 5-[methyl-[(3-methylthiophen-2-yl)methyl]sulfamoyl]-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)N(C)Cc1sccc1C |
| InChI | InChI=1S/C13H17N3O4S2/c1-4-20-13(17)10-7-14-15-12(10)22(18,19)16(3)8-11-9(2)5-6-21-11/h5-7H,4,8H2,1-3H3,(H,14,15) |
| InChIKey | FJJZRBAZHLOHTP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |