C9H15N3O3S — CID 60910848
5-methyl-N-(oxan-4-yl)-1H-pyrazole-4-sulfonamide (PubChem CID 60910848) has the molecular formula C9H15N3O3S and a molecular weight of 245.30 g/mol. Its IUPAC name is 5-methyl-N-(oxan-4-yl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-N-(oxan-4-yl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60910848 |
| Molecular Formula | C9H15N3O3S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-methyl-N-(oxan-4-yl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NC1CCOCC1 |
| InChI | InChI=1S/C9H15N3O3S/c1-7-9(6-10-11-7)16(13,14)12-8-2-4-15-5-3-8/h6,8,12H,2-5H2,1H3,(H,10,11) |
| InChIKey | TYPOOCQFECAQHQ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |