C11H19N3O3S — CID 115563568
N-(2,2-dimethyloxan-4-yl)-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 115563568) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115563568 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C11H19N3O3S/c1-8-10(7-12-13-8)18(15,16)14-9-4-5-17-11(2,3)6-9/h7,9,14H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | YHPDIGJXIQWFBC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |