C11H20N6O3S — CID 77002496
N'-hydroxy-2-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]piperidin-1-yl]ethanimidamide (PubChem CID 77002496) has the molecular formula C11H20N6O3S and a molecular weight of 316.39 g/mol. Its IUPAC name is N'-hydroxy-2-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]piperidin-1-yl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]piperidin-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 77002496 |
| Molecular Formula | C11H20N6O3S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N'-hydroxy-2-[4-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]piperidin-1-yl]ethanimidamide |
| SMILES | Cc1[nH]ncc1S(=O)(=O)NC1CCN(CC(N)=NO)CC1 |
| InChI | InChI=1S/C11H20N6O3S/c1-8-10(6-13-14-8)21(19,20)16-9-2-4-17(5-3-9)7-11(12)15-18/h6,9,16,18H,2-5,7H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | DNSRYUPGDAUMNW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|