C9H13BrN2O2S2 — CID 79988606
5-bromo-4-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide (PubChem CID 79988606) has the molecular formula C9H13BrN2O2S2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79988606 |
| Molecular Formula | C9H13BrN2O2S2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | 5-bromo-4-methyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCNC2)sc1Br |
| InChI | InChI=1S/C9H13BrN2O2S2/c1-6-4-8(15-9(6)10)16(13,14)12-7-2-3-11-5-7/h4,7,11-12H,2-3,5H2,1H3 |
| InChIKey | HJRPUCCECOCDDA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |