C10H12BrNO2S2 — CID 115695688
5-bromo-N-cyclopent-3-en-1-yl-4-methylthiophene-2-sulfonamide (PubChem CID 115695688) has the molecular formula C10H12BrNO2S2 and a molecular weight of 322.25 g/mol. Its IUPAC name is 5-bromo-N-cyclopent-3-en-1-yl-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-cyclopent-3-en-1-yl-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115695688 |
| Molecular Formula | C10H12BrNO2S2 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 5-bromo-N-cyclopent-3-en-1-yl-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CC=CC2)sc1Br |
| InChI | InChI=1S/C10H12BrNO2S2/c1-7-6-9(15-10(7)11)16(13,14)12-8-4-2-3-5-8/h2-3,6,8,12H,4-5H2,1H3 |
| InChIKey | ATDUSWWYZYMBGX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|