C10H14BrNO3S3 — CID 113347709
5-bromo-4-methyl-N-(1-oxothian-4-yl)thiophene-2-sulfonamide (PubChem CID 113347709) has the molecular formula C10H14BrNO3S3 and a molecular weight of 372.33 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(1-oxothian-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(1-oxothian-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113347709 |
| Molecular Formula | C10H14BrNO3S3 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 5-bromo-4-methyl-N-(1-oxothian-4-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCS(=O)CC2)sc1Br |
| InChI | InChI=1S/C10H14BrNO3S3/c1-7-6-9(16-10(7)11)18(14,15)12-8-2-4-17(13)5-3-8/h6,8,12H,2-5H2,1H3 |
| InChIKey | XDYZYSQZQLMXOZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |